C12H25NO4 — CID 87995715
(2R,3R,4S,5S)-6-butylimino-2-ethylhexane-1,3,4,5-tetrol (PubChem CID 87995715) has the molecular formula C12H25NO4 and a molecular weight of 247.33 g/mol. Its IUPAC name is (2R,3R,4S,5S)-6-butylimino-2-ethylhexane-1,3,4,5-tetrol.
| Compound Name | (2R,3R,4S,5S)-6-butylimino-2-ethylhexane-1,3,4,5-tetrol |
|---|---|
| PubChem CID | 87995715 |
| Molecular Formula | C12H25NO4 |
| Molecular Weight | 247.33 g/mol |
| Exact Mass | 247.18 |
| IUPAC Name | (2R,3R,4S,5S)-6-butylimino-2-ethylhexane-1,3,4,5-tetrol |
| SMILES | CCCC/N=C/[C@H](O)[C@@H](O)[C@H](O)[C@H](CC)CO |
| InChI | InChI=1S/C12H25NO4/c1-3-5-6-13-7-10(15)12(17)11(16)9(4-2)8-14/h7,9-12,14-17H,3-6,8H2,1-2H3/b13-7+/t9-,10+,11-,12-/m1/s1 |
| InChIKey | BPEMTSHOBOAUPC-NQMAMANJSA-N |
| XLogP | -0.04 |
| TPSA | 93.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.33 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|