C6H11NO3 — CID 11019001
(2R,3R,4R,5S)-2-methyl-2,3,4,5-tetrahydropyridine-3,4,5-triol (PubChem CID 11019001) has the molecular formula C6H11NO3 and a molecular weight of 145.16 g/mol. Its IUPAC name is (2R,3R,4R,5S)-2-methyl-2,3,4,5-tetrahydropyridine-3,4,5-triol.
| Compound Name | (2R,3R,4R,5S)-2-methyl-2,3,4,5-tetrahydropyridine-3,4,5-triol |
|---|---|
| PubChem CID | 11019001 |
| Molecular Formula | C6H11NO3 |
| Molecular Weight | 145.16 g/mol |
| Exact Mass | 145.07 |
| IUPAC Name | (2R,3R,4R,5S)-2-methyl-2,3,4,5-tetrahydropyridine-3,4,5-triol |
| SMILES | C[C@H]1N=C[C@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H11NO3/c1-3-5(9)6(10)4(8)2-7-3/h2-6,8-10H,1H3/t3-,4+,5-,6+/m1/s1 |
| InChIKey | AGCJNOKLUACRPA-MOJAZDJTSA-N |
| XLogP | -1.46 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.16 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |