About (2S,3S,4S)-2-methyl-3,4-dihydro-2H-pyrrole-3,4-diol
(2S,3S,4S)-2-methyl-3,4-dihydro-2H-pyrrole-3,4-diol (PubChem CID 46226810) has the molecular formula C5H9NO2
and a molecular weight of 115.13 g/mol. Its IUPAC name is (2S,3S,4S)-2-methyl-3,4-dihydro-2H-pyrrole-3,4-diol.
Analyze (2S,3S,4S)-2-methyl-3,4-dihydro-2H-pyrrole-3,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,3S,4S)-2-methyl-3,4-dihydro-2H-pyrrole-3,4-diol?
The IUPAC name of (2S,3S,4S)-2-methyl-3,4-dihydro-2H-pyrrole-3,4-diol (CID 46226810) is (2S,3S,4S)-2-methyl-3,4-dihydro-2H-pyrrole-3,4-diol.
What is the SMILES notation for (2S,3S,4S)-2-methyl-3,4-dihydro-2H-pyrrole-3,4-diol?
The canonical SMILES for (2S,3S,4S)-2-methyl-3,4-dihydro-2H-pyrrole-3,4-diol is C[C@@H]1N=C[C@H](O)[C@H]1O.
What is the InChIKey of (2S,3S,4S)-2-methyl-3,4-dihydro-2H-pyrrole-3,4-diol?
The InChIKey is QWXULCZCTYGDOT-YUPRTTJUSA-N. The full InChI is InChI=1S/C5H9NO2/c1-3-5(8)4(7)2-6-3/h2-5,7-8H,1H3/t3-,4-,5-/m0/s1.
What are the key properties of (2S,3S,4S)-2-methyl-3,4-dihydro-2H-pyrrole-3,4-diol?
(2S,3S,4S)-2-methyl-3,4-dihydro-2H-pyrrole-3,4-diol has a molecular weight of 115.13 g/mol, XLogP of -0.82, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3S,4S)-2-methyl-3,4-dihydro-2H-pyrrole-3,4-diol is sourced from PubChem (CID 46226810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).