C6H11NO4 — CID 56835758
(3S,4R,5R,6S)-3,4,5,6-tetrahydro-2H-azepine-3,4,5,6-tetrol (PubChem CID 56835758) has the molecular formula C6H11NO4 and a molecular weight of 161.16 g/mol. Its IUPAC name is (3S,4R,5R,6S)-3,4,5,6-tetrahydro-2H-azepine-3,4,5,6-tetrol.
| Compound Name | (3S,4R,5R,6S)-3,4,5,6-tetrahydro-2H-azepine-3,4,5,6-tetrol |
|---|---|
| PubChem CID | 56835758 |
| Molecular Formula | C6H11NO4 |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.07 |
| IUPAC Name | (3S,4R,5R,6S)-3,4,5,6-tetrahydro-2H-azepine-3,4,5,6-tetrol |
| SMILES | O[C@H]1[C@H](O)[C@@H](O)CN=C[C@@H]1O |
| InChI | InChI=1S/C6H11NO4/c8-3-1-7-2-4(9)6(11)5(3)10/h1,3-6,8-11H,2H2/t3-,4-,5+,6+/m0/s1 |
| InChIKey | QTZYKQBALKWQDN-UNTFVMJOSA-N |
| XLogP | -2.49 |
| TPSA | 93.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | -2.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |