C6H6F3NO3 — CID 10352669
2-[(2,2,2-trifluoroacetyl)amino]but-3-enoic acid (PubChem CID 10352669) has the molecular formula C6H6F3NO3 and a molecular weight of 197.11 g/mol. Its IUPAC name is 2-[(2,2,2-trifluoroacetyl)amino]but-3-enoic acid.
| Compound Name | 2-[(2,2,2-trifluoroacetyl)amino]but-3-enoic acid |
|---|---|
| PubChem CID | 10352669 |
| Molecular Formula | C6H6F3NO3 |
| Molecular Weight | 197.11 g/mol |
| Exact Mass | 197.03 |
| IUPAC Name | 2-[(2,2,2-trifluoroacetyl)amino]but-3-enoic acid |
| SMILES | C=CC(NC(=O)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C6H6F3NO3/c1-2-3(4(11)12)10-5(13)6(7,8)9/h2-3H,1H2,(H,10,13)(H,11,12) |
| InChIKey | QNKJLISBSSVMAE-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.11 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|