C17H28N4O2 — CID 103527562
tert-butyl N-[2-[(5-cyano-1-methylpyrrol-3-yl)methylamino]ethyl]-N-propylcarbamate (PubChem CID 103527562) has the molecular formula C17H28N4O2 and a molecular weight of 320.44 g/mol. Its IUPAC name is tert-butyl N-[2-[(5-cyano-1-methylpyrrol-3-yl)methylamino]ethyl]-N-propylcarbamate.
| Compound Name | tert-butyl N-[2-[(5-cyano-1-methylpyrrol-3-yl)methylamino]ethyl]-N-propylcarbamate |
|---|---|
| PubChem CID | 103527562 |
| Molecular Formula | C17H28N4O2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | tert-butyl N-[2-[(5-cyano-1-methylpyrrol-3-yl)methylamino]ethyl]-N-propylcarbamate |
| SMILES | CCCN(CCNCc1cc(C#N)n(C)c1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H28N4O2/c1-6-8-21(16(22)23-17(2,3)4)9-7-19-12-14-10-15(11-18)20(5)13-14/h10,13,19H,6-9,12H2,1-5H3 |
| InChIKey | LQXHNGHYIGDSPX-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 70.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|