C9H14O5 — CID 10352808
5-[(E)-3,4-dihydroxybut-2-enyl]-4-(hydroxymethyl)oxolan-2-one (PubChem CID 10352808) has the molecular formula C9H14O5 and a molecular weight of 202.21 g/mol. Its IUPAC name is 5-[(E)-3,4-dihydroxybut-2-enyl]-4-(hydroxymethyl)oxolan-2-one.
| Compound Name | 5-[(E)-3,4-dihydroxybut-2-enyl]-4-(hydroxymethyl)oxolan-2-one |
|---|---|
| PubChem CID | 10352808 |
| Molecular Formula | C9H14O5 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | 5-[(E)-3,4-dihydroxybut-2-enyl]-4-(hydroxymethyl)oxolan-2-one |
| SMILES | O=C1CC(CO)C(C/C=C(/O)CO)O1 |
| InChI | InChI=1S/C9H14O5/c10-4-6-3-9(13)14-8(6)2-1-7(12)5-11/h1,6,8,10-12H,2-5H2/b7-1+ |
| InChIKey | KTVIKBKYFXNRKZ-LREOWRDNSA-N |
| XLogP | -0.27 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|