C10H19F4NO — CID 103529315
4-methoxy-4-methyl-N-(2,2,3,3-tetrafluoropropyl)pentan-2-amine (PubChem CID 103529315) has the molecular formula C10H19F4NO and a molecular weight of 245.26 g/mol. Its IUPAC name is 4-methoxy-4-methyl-N-(2,2,3,3-tetrafluoropropyl)pentan-2-amine.
| Compound Name | 4-methoxy-4-methyl-N-(2,2,3,3-tetrafluoropropyl)pentan-2-amine |
|---|---|
| PubChem CID | 103529315 |
| Molecular Formula | C10H19F4NO |
| Molecular Weight | 245.26 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | 4-methoxy-4-methyl-N-(2,2,3,3-tetrafluoropropyl)pentan-2-amine |
| SMILES | COC(C)(C)CC(C)NCC(F)(F)C(F)F |
| InChI | InChI=1S/C10H19F4NO/c1-7(5-9(2,3)16-4)15-6-10(13,14)8(11)12/h7-8,15H,5-6H2,1-4H3 |
| InChIKey | ZEDSCIZSHQFWML-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.26 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|