C11H20N4O2 — CID 103545930
methyl 5-amino-1-[1-(dimethylamino)propan-2-yl]-2-methylimidazole-4-carboxylate (PubChem CID 103545930) has the molecular formula C11H20N4O2 and a molecular weight of 240.31 g/mol. Its IUPAC name is methyl 5-amino-1-[1-(dimethylamino)propan-2-yl]-2-methylimidazole-4-carboxylate.
| Compound Name | methyl 5-amino-1-[1-(dimethylamino)propan-2-yl]-2-methylimidazole-4-carboxylate |
|---|---|
| PubChem CID | 103545930 |
| Molecular Formula | C11H20N4O2 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | methyl 5-amino-1-[1-(dimethylamino)propan-2-yl]-2-methylimidazole-4-carboxylate |
| SMILES | COC(=O)c1nc(C)n(C(C)CN(C)C)c1N |
| InChI | InChI=1S/C11H20N4O2/c1-7(6-14(3)4)15-8(2)13-9(10(15)12)11(16)17-5/h7H,6,12H2,1-5H3 |
| InChIKey | MXLXMYXWCKNVQO-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 73.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |