C12H17N3O2 — CID 106223728
methyl 5-amino-1-hex-1-yn-3-yl-2-methylimidazole-4-carboxylate (PubChem CID 106223728) has the molecular formula C12H17N3O2 and a molecular weight of 235.29 g/mol. Its IUPAC name is methyl 5-amino-1-hex-1-yn-3-yl-2-methylimidazole-4-carboxylate.
| Compound Name | methyl 5-amino-1-hex-1-yn-3-yl-2-methylimidazole-4-carboxylate |
|---|---|
| PubChem CID | 106223728 |
| Molecular Formula | C12H17N3O2 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | methyl 5-amino-1-hex-1-yn-3-yl-2-methylimidazole-4-carboxylate |
| SMILES | C#CC(CCC)n1c(C)nc(C(=O)OC)c1N |
| InChI | InChI=1S/C12H17N3O2/c1-5-7-9(6-2)15-8(3)14-10(11(15)13)12(16)17-4/h2,9H,5,7,13H2,1,3-4H3 |
| InChIKey | ADAKLKQWNMNLAG-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|