C11H16ClFN2O — CID 103553723
4-chloro-5-fluoro-6-pentoxybenzene-1,3-diamine (PubChem CID 103553723) has the molecular formula C11H16ClFN2O and a molecular weight of 246.71 g/mol. Its IUPAC name is 4-chloro-5-fluoro-6-pentoxybenzene-1,3-diamine.
| Compound Name | 4-chloro-5-fluoro-6-pentoxybenzene-1,3-diamine |
|---|---|
| PubChem CID | 103553723 |
| Molecular Formula | C11H16ClFN2O |
| Molecular Weight | 246.71 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 4-chloro-5-fluoro-6-pentoxybenzene-1,3-diamine |
| SMILES | CCCCCOc1c(N)cc(N)c(Cl)c1F |
| InChI | InChI=1S/C11H16ClFN2O/c1-2-3-4-5-16-11-8(15)6-7(14)9(12)10(11)13/h6H,2-5,14-15H2,1H3 |
| InChIKey | MFWPZZWFEXGRQW-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.71 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|