C11H16ClFN2O2 — CID 103553765
4-chloro-5-fluoro-6-(2-propoxyethoxy)benzene-1,3-diamine (PubChem CID 103553765) has the molecular formula C11H16ClFN2O2 and a molecular weight of 262.71 g/mol. Its IUPAC name is 4-chloro-5-fluoro-6-(2-propoxyethoxy)benzene-1,3-diamine.
| Compound Name | 4-chloro-5-fluoro-6-(2-propoxyethoxy)benzene-1,3-diamine |
|---|---|
| PubChem CID | 103553765 |
| Molecular Formula | C11H16ClFN2O2 |
| Molecular Weight | 262.71 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | 4-chloro-5-fluoro-6-(2-propoxyethoxy)benzene-1,3-diamine |
| SMILES | CCCOCCOc1c(N)cc(N)c(Cl)c1F |
| InChI | InChI=1S/C11H16ClFN2O2/c1-2-3-16-4-5-17-11-8(15)6-7(14)9(12)10(11)13/h6H,2-5,14-15H2,1H3 |
| InChIKey | UCQYZNWDPULAJU-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.71 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|