C16H20LiNO2 — CID 10355489
lithium [(2E)-2-ethylidene-4,4-dimethylcyclopentyl]oxycarbonyl-phenylazanide (PubChem CID 10355489) has the molecular formula C16H20LiNO2 and a molecular weight of 265.28 g/mol. Its IUPAC name is lithium [(2E)-2-ethylidene-4,4-dimethylcyclopentyl]oxycarbonyl-phenylazanide.
| Compound Name | lithium [(2E)-2-ethylidene-4,4-dimethylcyclopentyl]oxycarbonyl-phenylazanide |
|---|---|
| PubChem CID | 10355489 |
| Molecular Formula | C16H20LiNO2 |
| Molecular Weight | 265.28 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | lithium [(2E)-2-ethylidene-4,4-dimethylcyclopentyl]oxycarbonyl-phenylazanide |
| SMILES | C/C=C1\CC(C)(C)CC1OC(=O)[N-]c1ccccc1.[Li+] |
| InChI | InChI=1S/C16H21NO2.Li/c1-4-12-10-16(2,3)11-14(12)19-15(18)17-13-8-6-5-7-9-13;/h4-9,14H,10-11H2,1-3H3,(H,17,18);/q;+1/p-1/b12-4+; |
| InChIKey | BBAXTUQLLZGYME-AQCBZIOHSA-M |
| XLogP | 1.97 |
| TPSA | 40.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.28 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|