C8H15N5O2 — CID 103554965
N'-(2,3-dimethyl-5-nitroimidazol-4-yl)-N'-methylethane-1,2-diamine (PubChem CID 103554965) has the molecular formula C8H15N5O2 and a molecular weight of 213.24 g/mol. Its IUPAC name is N'-(2,3-dimethyl-5-nitroimidazol-4-yl)-N'-methylethane-1,2-diamine.
| Compound Name | N'-(2,3-dimethyl-5-nitroimidazol-4-yl)-N'-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 103554965 |
| Molecular Formula | C8H15N5O2 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | N'-(2,3-dimethyl-5-nitroimidazol-4-yl)-N'-methylethane-1,2-diamine |
| SMILES | Cc1nc([N+](=O)[O-])c(N(C)CCN)n1C |
| InChI | InChI=1S/C8H15N5O2/c1-6-10-7(13(14)15)8(12(6)3)11(2)5-4-9/h4-5,9H2,1-3H3 |
| InChIKey | HLFPBORCEGOVGG-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 90.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|