C7H12Br2O — CID 10355860
2-bromo-5-(bromomethyl)-3,3-dimethyloxolane (PubChem CID 10355860) has the molecular formula C7H12Br2O and a molecular weight of 271.98 g/mol. Its IUPAC name is 2-bromo-5-(bromomethyl)-3,3-dimethyloxolane.
| Compound Name | 2-bromo-5-(bromomethyl)-3,3-dimethyloxolane |
|---|---|
| PubChem CID | 10355860 |
| Molecular Formula | C7H12Br2O |
| Molecular Weight | 271.98 g/mol |
| Exact Mass | 269.93 |
| IUPAC Name | 2-bromo-5-(bromomethyl)-3,3-dimethyloxolane |
| SMILES | CC1(C)CC(CBr)OC1Br |
| InChI | InChI=1S/C7H12Br2O/c1-7(2)3-5(4-8)10-6(7)9/h5-6H,3-4H2,1-2H3 |
| InChIKey | IPOAHOGSONGXFC-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.98 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|