C12H11F2NO4 — CID 103566244
ethyl 2-(3-cyano-5-methoxyphenoxy)-2,2-difluoroacetate (PubChem CID 103566244) has the molecular formula C12H11F2NO4 and a molecular weight of 271.22 g/mol. Its IUPAC name is ethyl 2-(3-cyano-5-methoxyphenoxy)-2,2-difluoroacetate.
| Compound Name | ethyl 2-(3-cyano-5-methoxyphenoxy)-2,2-difluoroacetate |
|---|---|
| PubChem CID | 103566244 |
| Molecular Formula | C12H11F2NO4 |
| Molecular Weight | 271.22 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | ethyl 2-(3-cyano-5-methoxyphenoxy)-2,2-difluoroacetate |
| SMILES | CCOC(=O)C(F)(F)Oc1cc(C#N)cc(OC)c1 |
| InChI | InChI=1S/C12H11F2NO4/c1-3-18-11(16)12(13,14)19-10-5-8(7-15)4-9(6-10)17-2/h4-6H,3H2,1-2H3 |
| InChIKey | QDKSSUYRURWOAO-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.22 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |