C10H18N4 — CID 103568692
1-methyl-N-[(2-methylpyrrolidin-2-yl)methyl]pyrazol-3-amine (PubChem CID 103568692) has the molecular formula C10H18N4 and a molecular weight of 194.28 g/mol. Its IUPAC name is 1-methyl-N-[(2-methylpyrrolidin-2-yl)methyl]pyrazol-3-amine.
| Compound Name | 1-methyl-N-[(2-methylpyrrolidin-2-yl)methyl]pyrazol-3-amine |
|---|---|
| PubChem CID | 103568692 |
| Molecular Formula | C10H18N4 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | 1-methyl-N-[(2-methylpyrrolidin-2-yl)methyl]pyrazol-3-amine |
| SMILES | Cn1ccc(NCC2(C)CCCN2)n1 |
| InChI | InChI=1S/C10H18N4/c1-10(5-3-6-12-10)8-11-9-4-7-14(2)13-9/h4,7,12H,3,5-6,8H2,1-2H3,(H,11,13) |
| InChIKey | KXTLKKDLYUYTSO-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |