C8H11F4N3O2S — CID 103577916
3,5-dimethyl-N-(2,2,3,3-tetrafluoropropyl)-1H-pyrazole-4-sulfonamide (PubChem CID 103577916) has the molecular formula C8H11F4N3O2S and a molecular weight of 289.25 g/mol. Its IUPAC name is 3,5-dimethyl-N-(2,2,3,3-tetrafluoropropyl)-1H-pyrazole-4-sulfonamide.
| Compound Name | 3,5-dimethyl-N-(2,2,3,3-tetrafluoropropyl)-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 103577916 |
| Molecular Formula | C8H11F4N3O2S |
| Molecular Weight | 289.25 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | 3,5-dimethyl-N-(2,2,3,3-tetrafluoropropyl)-1H-pyrazole-4-sulfonamide |
| SMILES | Cc1n[nH]c(C)c1S(=O)(=O)NCC(F)(F)C(F)F |
| InChI | InChI=1S/C8H11F4N3O2S/c1-4-6(5(2)15-14-4)18(16,17)13-3-8(11,12)7(9)10/h7,13H,3H2,1-2H3,(H,14,15) |
| InChIKey | YHFXPNJPZUICQE-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.25 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|