C15H17F2N3 — CID 103587418
(2-cyclopentyl-5,8-difluoro-6-methylquinolin-4-yl)hydrazine (PubChem CID 103587418) has the molecular formula C15H17F2N3 and a molecular weight of 277.32 g/mol. Its IUPAC name is (2-cyclopentyl-5,8-difluoro-6-methylquinolin-4-yl)hydrazine.
| Compound Name | (2-cyclopentyl-5,8-difluoro-6-methylquinolin-4-yl)hydrazine |
|---|---|
| PubChem CID | 103587418 |
| Molecular Formula | C15H17F2N3 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | (2-cyclopentyl-5,8-difluoro-6-methylquinolin-4-yl)hydrazine |
| SMILES | Cc1cc(F)c2nc(C3CCCC3)cc(NN)c2c1F |
| InChI | InChI=1S/C15H17F2N3/c1-8-6-10(16)15-13(14(8)17)12(20-18)7-11(19-15)9-4-2-3-5-9/h6-7,9H,2-5,18H2,1H3,(H,19,20) |
| InChIKey | MCBHULSCIBDCBI-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|