C19H34O2Si — CID 10358794
(6E)-6-[6-[tert-butyl(dimethyl)silyl]oxyhexylidene]cyclohexene-1-carbaldehyde (PubChem CID 10358794) has the molecular formula C19H34O2Si and a molecular weight of 322.56 g/mol. Its IUPAC name is (6E)-6-[6-[tert-butyl(dimethyl)silyl]oxyhexylidene]cyclohexene-1-carbaldehyde.
| Compound Name | (6E)-6-[6-[tert-butyl(dimethyl)silyl]oxyhexylidene]cyclohexene-1-carbaldehyde |
|---|---|
| PubChem CID | 10358794 |
| Molecular Formula | C19H34O2Si |
| Molecular Weight | 322.56 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | (6E)-6-[6-[tert-butyl(dimethyl)silyl]oxyhexylidene]cyclohexene-1-carbaldehyde |
| SMILES | CC(C)(C)[Si](C)(C)OCCCCC/C=C1\CCCC=C1C=O |
| InChI | InChI=1S/C19H34O2Si/c1-19(2,3)22(4,5)21-15-11-7-6-8-12-17-13-9-10-14-18(17)16-20/h12,14,16H,6-11,13,15H2,1-5H3/b17-12+ |
| InChIKey | HEILNYYELLOXRD-SFQUDFHCSA-N |
| XLogP | 5.80 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.56 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|