C17H13BrO2 — CID 10359187
5-(bromomethyl)-3,3-diphenylfuran-2-one (PubChem CID 10359187) has the molecular formula C17H13BrO2 and a molecular weight of 329.19 g/mol. Its IUPAC name is 5-(bromomethyl)-3,3-diphenylfuran-2-one.
| Compound Name | 5-(bromomethyl)-3,3-diphenylfuran-2-one |
|---|---|
| PubChem CID | 10359187 |
| Molecular Formula | C17H13BrO2 |
| Molecular Weight | 329.19 g/mol |
| Exact Mass | 328.01 |
| IUPAC Name | 5-(bromomethyl)-3,3-diphenylfuran-2-one |
| SMILES | O=C1OC(CBr)=CC1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H13BrO2/c18-12-15-11-17(16(19)20-15,13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-11H,12H2 |
| InChIKey | OZLBLBUPXDCQPJ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.19 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|