C13H9Cl2F3N2O2 — CID 10360692
5-[chloro(difluoro)methyl]-3-(4-chloro-2-fluorophenyl)-N-ethyl-1,2-oxazole-4-carboxamide (PubChem CID 10360692) has the molecular formula C13H9Cl2F3N2O2 and a molecular weight of 353.13 g/mol. Its IUPAC name is 5-[chloro(difluoro)methyl]-3-(4-chloro-2-fluorophenyl)-N-ethyl-1,2-oxazole-4-carboxamide.
| Compound Name | 5-[chloro(difluoro)methyl]-3-(4-chloro-2-fluorophenyl)-N-ethyl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 10360692 |
| Molecular Formula | C13H9Cl2F3N2O2 |
| Molecular Weight | 353.13 g/mol |
| Exact Mass | 352.00 |
| IUPAC Name | 5-[chloro(difluoro)methyl]-3-(4-chloro-2-fluorophenyl)-N-ethyl-1,2-oxazole-4-carboxamide |
| SMILES | CCNC(=O)c1c(-c2ccc(Cl)cc2F)noc1C(F)(F)Cl |
| InChI | InChI=1S/C13H9Cl2F3N2O2/c1-2-19-12(21)9-10(20-22-11(9)13(15,17)18)7-4-3-6(14)5-8(7)16/h3-5H,2H2,1H3,(H,19,21) |
| InChIKey | ZTJFIEQOXFNNLH-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.13 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|