C14H7Cl2F3N2O3 — CID 10474827
5-[chloro(difluoro)methyl]-3-(4-chloro-2-fluoro-5-prop-2-ynoxyphenyl)-1,2-oxazole-4-carboxamide (PubChem CID 10474827) has the molecular formula C14H7Cl2F3N2O3 and a molecular weight of 379.12 g/mol. Its IUPAC name is 5-[chloro(difluoro)methyl]-3-(4-chloro-2-fluoro-5-prop-2-ynoxyphenyl)-1,2-oxazole-4-carboxamide.
| Compound Name | 5-[chloro(difluoro)methyl]-3-(4-chloro-2-fluoro-5-prop-2-ynoxyphenyl)-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 10474827 |
| Molecular Formula | C14H7Cl2F3N2O3 |
| Molecular Weight | 379.12 g/mol |
| Exact Mass | 377.98 |
| IUPAC Name | 5-[chloro(difluoro)methyl]-3-(4-chloro-2-fluoro-5-prop-2-ynoxyphenyl)-1,2-oxazole-4-carboxamide |
| SMILES | C#CCOc1cc(-c2noc(C(F)(F)Cl)c2C(N)=O)c(F)cc1Cl |
| InChI | InChI=1S/C14H7Cl2F3N2O3/c1-2-3-23-9-4-6(8(17)5-7(9)15)11-10(13(20)22)12(24-21-11)14(16,18)19/h1,4-5H,3H2,(H2,20,22) |
| InChIKey | BSDBZHZRGIKRKT-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.12 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|