C22H27N3O2 — CID 10361490
methyl (4S)-1-tert-butyl-3-phenyl-2-phenylimino-1,3-diazinane-4-carboxylate (PubChem CID 10361490) has the molecular formula C22H27N3O2 and a molecular weight of 365.48 g/mol. Its IUPAC name is methyl (4S)-1-tert-butyl-3-phenyl-2-phenylimino-1,3-diazinane-4-carboxylate.
| Compound Name | methyl (4S)-1-tert-butyl-3-phenyl-2-phenylimino-1,3-diazinane-4-carboxylate |
|---|---|
| PubChem CID | 10361490 |
| Molecular Formula | C22H27N3O2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | methyl (4S)-1-tert-butyl-3-phenyl-2-phenylimino-1,3-diazinane-4-carboxylate |
| SMILES | COC(=O)[C@@H]1CCN(C(C)(C)C)/C(=N\c2ccccc2)N1c1ccccc1 |
| InChI | InChI=1S/C22H27N3O2/c1-22(2,3)24-16-15-19(20(26)27-4)25(18-13-9-6-10-14-18)21(24)23-17-11-7-5-8-12-17/h5-14,19H,15-16H2,1-4H3/b23-21+/t19-/m0/s1 |
| InChIKey | BWENRAOPFLZCSF-KFGJJWJMSA-N |
| XLogP | 4.23 |
| TPSA | 45.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|