C22H26N2O2S — CID 10385253
benzyl 3-tert-butyl-2-phenylimino-1,3-thiazinane-6-carboxylate (PubChem CID 10385253) has the molecular formula C22H26N2O2S and a molecular weight of 382.53 g/mol. Its IUPAC name is benzyl 3-tert-butyl-2-phenylimino-1,3-thiazinane-6-carboxylate.
| Compound Name | benzyl 3-tert-butyl-2-phenylimino-1,3-thiazinane-6-carboxylate |
|---|---|
| PubChem CID | 10385253 |
| Molecular Formula | C22H26N2O2S |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | benzyl 3-tert-butyl-2-phenylimino-1,3-thiazinane-6-carboxylate |
| SMILES | CC(C)(C)N1CCC(C(=O)OCc2ccccc2)S/C1=N\c1ccccc1 |
| InChI | InChI=1S/C22H26N2O2S/c1-22(2,3)24-15-14-19(20(25)26-16-17-10-6-4-7-11-17)27-21(24)23-18-12-8-5-9-13-18/h4-13,19H,14-16H2,1-3H3/b23-21- |
| InChIKey | BEHGWDQEQUJIQN-LNVKXUELSA-N |
| XLogP | 5.02 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|