C28H31N3O2 — CID 10411049
benzyl (4S)-1-tert-butyl-3-phenyl-2-phenylimino-1,3-diazinane-4-carboxylate (PubChem CID 10411049) has the molecular formula C28H31N3O2 and a molecular weight of 441.58 g/mol. Its IUPAC name is benzyl (4S)-1-tert-butyl-3-phenyl-2-phenylimino-1,3-diazinane-4-carboxylate.
| Compound Name | benzyl (4S)-1-tert-butyl-3-phenyl-2-phenylimino-1,3-diazinane-4-carboxylate |
|---|---|
| PubChem CID | 10411049 |
| Molecular Formula | C28H31N3O2 |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.24 |
| IUPAC Name | benzyl (4S)-1-tert-butyl-3-phenyl-2-phenylimino-1,3-diazinane-4-carboxylate |
| SMILES | CC(C)(C)N1CC[C@@H](C(=O)OCc2ccccc2)N(c2ccccc2)/C1=N/c1ccccc1 |
| InChI | InChI=1S/C28H31N3O2/c1-28(2,3)30-20-19-25(26(32)33-21-22-13-7-4-8-14-22)31(24-17-11-6-12-18-24)27(30)29-23-15-9-5-10-16-23/h4-18,25H,19-21H2,1-3H3/b29-27+/t25-/m0/s1 |
| InChIKey | OJSPZPZEASYZLV-FNLQBEHQSA-N |
| XLogP | 5.80 |
| TPSA | 45.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|