C17H23Cl2N3O3 — CID 10362812
N-[(3R)-3-amino-4-cyclohexyl-2-hydroxybutanoyl]-2,4-dichlorobenzohydrazide (PubChem CID 10362812) has the molecular formula C17H23Cl2N3O3 and a molecular weight of 388.30 g/mol. Its IUPAC name is N-[(3R)-3-amino-4-cyclohexyl-2-hydroxybutanoyl]-2,4-dichlorobenzohydrazide.
| Compound Name | N-[(3R)-3-amino-4-cyclohexyl-2-hydroxybutanoyl]-2,4-dichlorobenzohydrazide |
|---|---|
| PubChem CID | 10362812 |
| Molecular Formula | C17H23Cl2N3O3 |
| Molecular Weight | 388.30 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | N-[(3R)-3-amino-4-cyclohexyl-2-hydroxybutanoyl]-2,4-dichlorobenzohydrazide |
| SMILES | N[C@H](CC1CCCCC1)C(O)C(=O)N(N)C(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H23Cl2N3O3/c18-11-6-7-12(13(19)9-11)16(24)22(21)17(25)15(23)14(20)8-10-4-2-1-3-5-10/h6-7,9-10,14-15,23H,1-5,8,20-21H2/t14-,15?/m1/s1 |
| InChIKey | HVFVTPMAENUEBO-GICMACPYSA-N |
| XLogP | 2.49 |
| TPSA | 109.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.30 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|