C17H25N3O4 — CID 10449616
N-[(3R)-3-amino-4-cyclohexyl-2-hydroxybutanoyl]-4-hydroxybenzohydrazide (PubChem CID 10449616) has the molecular formula C17H25N3O4 and a molecular weight of 335.40 g/mol. Its IUPAC name is N-[(3R)-3-amino-4-cyclohexyl-2-hydroxybutanoyl]-4-hydroxybenzohydrazide.
| Compound Name | N-[(3R)-3-amino-4-cyclohexyl-2-hydroxybutanoyl]-4-hydroxybenzohydrazide |
|---|---|
| PubChem CID | 10449616 |
| Molecular Formula | C17H25N3O4 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | N-[(3R)-3-amino-4-cyclohexyl-2-hydroxybutanoyl]-4-hydroxybenzohydrazide |
| SMILES | N[C@H](CC1CCCCC1)C(O)C(=O)N(N)C(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C17H25N3O4/c18-14(10-11-4-2-1-3-5-11)15(22)17(24)20(19)16(23)12-6-8-13(21)9-7-12/h6-9,11,14-15,21-22H,1-5,10,18-19H2/t14-,15?/m1/s1 |
| InChIKey | HBWZULRUWLOILM-GICMACPYSA-N |
| XLogP | 0.89 |
| TPSA | 129.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|