C14H28N2O4 — CID 70065085
(3R)-3-amino-4-cyclohexyl-2-hydroxy-N,N-bis(methoxymethyl)butanamide (PubChem CID 70065085) has the molecular formula C14H28N2O4 and a molecular weight of 288.39 g/mol. Its IUPAC name is (3R)-3-amino-4-cyclohexyl-2-hydroxy-N,N-bis(methoxymethyl)butanamide.
| Compound Name | (3R)-3-amino-4-cyclohexyl-2-hydroxy-N,N-bis(methoxymethyl)butanamide |
|---|---|
| PubChem CID | 70065085 |
| Molecular Formula | C14H28N2O4 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | (3R)-3-amino-4-cyclohexyl-2-hydroxy-N,N-bis(methoxymethyl)butanamide |
| SMILES | COCN(COC)C(=O)C(O)[C@H](N)CC1CCCCC1 |
| InChI | InChI=1S/C14H28N2O4/c1-19-9-16(10-20-2)14(18)13(17)12(15)8-11-6-4-3-5-7-11/h11-13,17H,3-10,15H2,1-2H3/t12-,13?/m1/s1 |
| InChIKey | RQRBXAIYNBBAMS-PZORYLMUSA-N |
| XLogP | 0.68 |
| TPSA | 85.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|