C12H18FN3 — CID 103634730
5-fluoro-6-methyl-N-(4-methylcyclohexyl)pyrimidin-4-amine (PubChem CID 103634730) has the molecular formula C12H18FN3 and a molecular weight of 223.29 g/mol. Its IUPAC name is 5-fluoro-6-methyl-N-(4-methylcyclohexyl)pyrimidin-4-amine.
| Compound Name | 5-fluoro-6-methyl-N-(4-methylcyclohexyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 103634730 |
| Molecular Formula | C12H18FN3 |
| Molecular Weight | 223.29 g/mol |
| Exact Mass | 223.15 |
| IUPAC Name | 5-fluoro-6-methyl-N-(4-methylcyclohexyl)pyrimidin-4-amine |
| SMILES | Cc1ncnc(NC2CCC(C)CC2)c1F |
| InChI | InChI=1S/C12H18FN3/c1-8-3-5-10(6-4-8)16-12-11(13)9(2)14-7-15-12/h7-8,10H,3-6H2,1-2H3,(H,14,15,16) |
| InChIKey | CBQAKGBHIAPRGQ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.29 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |