C22H38O5Si — CID 10364266
diethyl (2E,4E,6S,7S,8E)-7-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethyldeca-2,4,8-trienedioate (PubChem CID 10364266) has the molecular formula C22H38O5Si and a molecular weight of 410.63 g/mol. Its IUPAC name is diethyl (2E,4E,6S,7S,8E)-7-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethyldeca-2,4,8-trienedioate.
| Compound Name | diethyl (2E,4E,6S,7S,8E)-7-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethyldeca-2,4,8-trienedioate |
|---|---|
| PubChem CID | 10364266 |
| Molecular Formula | C22H38O5Si |
| Molecular Weight | 410.63 g/mol |
| Exact Mass | 410.25 |
| IUPAC Name | diethyl (2E,4E,6S,7S,8E)-7-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethyldeca-2,4,8-trienedioate |
| SMILES | CCOC(=O)/C=C/C(C)=C/[C@H](C)[C@H](/C=C/C(=O)OCC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H38O5Si/c1-10-25-20(23)14-12-17(3)16-18(4)19(13-15-21(24)26-11-2)27-28(8,9)22(5,6)7/h12-16,18-19H,10-11H2,1-9H3/b14-12+,15-13+,17-16+/t18-,19-/m0/s1 |
| InChIKey | AQRGEYGMCINYMW-XRQBOUKZSA-N |
| XLogP | 5.20 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.63 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|