C14H20N4OS — CID 103649065
3-[2-[(5-pyridin-3-yl-1H-pyrazol-4-yl)methylamino]ethylsulfanyl]propan-1-ol (PubChem CID 103649065) has the molecular formula C14H20N4OS and a molecular weight of 292.41 g/mol. Its IUPAC name is 3-[2-[(5-pyridin-3-yl-1H-pyrazol-4-yl)methylamino]ethylsulfanyl]propan-1-ol.
| Compound Name | 3-[2-[(5-pyridin-3-yl-1H-pyrazol-4-yl)methylamino]ethylsulfanyl]propan-1-ol |
|---|---|
| PubChem CID | 103649065 |
| Molecular Formula | C14H20N4OS |
| Molecular Weight | 292.41 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 3-[2-[(5-pyridin-3-yl-1H-pyrazol-4-yl)methylamino]ethylsulfanyl]propan-1-ol |
| SMILES | OCCCSCCNCc1cn[nH]c1-c1cccnc1 |
| InChI | InChI=1S/C14H20N4OS/c19-6-2-7-20-8-5-16-10-13-11-17-18-14(13)12-3-1-4-15-9-12/h1,3-4,9,11,16,19H,2,5-8,10H2,(H,17,18) |
| InChIKey | WQESUHQWJZGTQZ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.41 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|