C20H24N4 — CID 71889196
N-[(5-pyridin-3-yl-1H-pyrazol-4-yl)methyl]-2-(2,4,6-trimethylphenyl)ethanamine (PubChem CID 71889196) has the molecular formula C20H24N4 and a molecular weight of 320.44 g/mol. Its IUPAC name is N-[(5-pyridin-3-yl-1H-pyrazol-4-yl)methyl]-2-(2,4,6-trimethylphenyl)ethanamine.
| Compound Name | N-[(5-pyridin-3-yl-1H-pyrazol-4-yl)methyl]-2-(2,4,6-trimethylphenyl)ethanamine |
|---|---|
| PubChem CID | 71889196 |
| Molecular Formula | C20H24N4 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | N-[(5-pyridin-3-yl-1H-pyrazol-4-yl)methyl]-2-(2,4,6-trimethylphenyl)ethanamine |
| SMILES | Cc1cc(C)c(CCNCc2cn[nH]c2-c2cccnc2)c(C)c1 |
| InChI | InChI=1S/C20H24N4/c1-14-9-15(2)19(16(3)10-14)6-8-22-12-18-13-23-24-20(18)17-5-4-7-21-11-17/h4-5,7,9-11,13,22H,6,8,12H2,1-3H3,(H,23,24) |
| InChIKey | GQGJHWHDAIGELF-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|