C21H36O3S2Si — CID 10365308
(3S)-4-[(2S)-2-phenylsulfanylthian-2-yl]-3-(2-trimethylsilylethoxymethoxy)butan-1-ol (PubChem CID 10365308) has the molecular formula C21H36O3S2Si and a molecular weight of 428.74 g/mol. Its IUPAC name is (3S)-4-[(2S)-2-phenylsulfanylthian-2-yl]-3-(2-trimethylsilylethoxymethoxy)butan-1-ol.
| Compound Name | (3S)-4-[(2S)-2-phenylsulfanylthian-2-yl]-3-(2-trimethylsilylethoxymethoxy)butan-1-ol |
|---|---|
| PubChem CID | 10365308 |
| Molecular Formula | C21H36O3S2Si |
| Molecular Weight | 428.74 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | (3S)-4-[(2S)-2-phenylsulfanylthian-2-yl]-3-(2-trimethylsilylethoxymethoxy)butan-1-ol |
| SMILES | C[Si](C)(C)CCOCO[C@@H](CCO)C[C@@]1(Sc2ccccc2)CCCCS1 |
| InChI | InChI=1S/C21H36O3S2Si/c1-27(2,3)16-14-23-18-24-19(11-13-22)17-21(12-7-8-15-25-21)26-20-9-5-4-6-10-20/h4-6,9-10,19,22H,7-8,11-18H2,1-3H3/t19-,21-/m0/s1 |
| InChIKey | AEXYZALEBNCCQG-FPOVZHCZSA-N |
| XLogP | 5.86 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.74 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|