C16H12Cl3F3O4S — CID 10367155
3-[(4-chlorophenyl)-(3,4-dichlorophenyl)methyl]sulfonyl-1,1,1-trifluoropropane-2,2-diol (PubChem CID 10367155) has the molecular formula C16H12Cl3F3O4S and a molecular weight of 463.69 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)-(3,4-dichlorophenyl)methyl]sulfonyl-1,1,1-trifluoropropane-2,2-diol.
| Compound Name | 3-[(4-chlorophenyl)-(3,4-dichlorophenyl)methyl]sulfonyl-1,1,1-trifluoropropane-2,2-diol |
|---|---|
| PubChem CID | 10367155 |
| Molecular Formula | C16H12Cl3F3O4S |
| Molecular Weight | 463.69 g/mol |
| Exact Mass | 461.95 |
| IUPAC Name | 3-[(4-chlorophenyl)-(3,4-dichlorophenyl)methyl]sulfonyl-1,1,1-trifluoropropane-2,2-diol |
| SMILES | O=S(=O)(CC(O)(O)C(F)(F)F)C(c1ccc(Cl)cc1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H12Cl3F3O4S/c17-11-4-1-9(2-5-11)14(10-3-6-12(18)13(19)7-10)27(25,26)8-15(23,24)16(20,21)22/h1-7,14,23-24H,8H2 |
| InChIKey | ZEMQBCJPBNXDFU-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.69 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|