C12H17ClO3S — CID 111435441
1-[1-(4-chlorophenyl)ethylsulfonyl]-2-methylpropan-2-ol (PubChem CID 111435441) has the molecular formula C12H17ClO3S and a molecular weight of 276.79 g/mol. Its IUPAC name is 1-[1-(4-chlorophenyl)ethylsulfonyl]-2-methylpropan-2-ol.
| Compound Name | 1-[1-(4-chlorophenyl)ethylsulfonyl]-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 111435441 |
| Molecular Formula | C12H17ClO3S |
| Molecular Weight | 276.79 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | 1-[1-(4-chlorophenyl)ethylsulfonyl]-2-methylpropan-2-ol |
| SMILES | CC(c1ccc(Cl)cc1)S(=O)(=O)CC(C)(C)O |
| InChI | InChI=1S/C12H17ClO3S/c1-9(10-4-6-11(13)7-5-10)17(15,16)8-12(2,3)14/h4-7,9,14H,8H2,1-3H3 |
| InChIKey | WPNPMYXCXHHRFT-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.79 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |