C25H28N+ — CID 10367392
1,1-dimethyl-4-(2-propan-2-ylidene-9-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenyl)-3,6-dihydro-2H-pyridin-1-ium (PubChem CID 10367392) has the molecular formula C25H28N+ and a molecular weight of 342.51 g/mol. Its IUPAC name is 1,1-dimethyl-4-(2-propan-2-ylidene-9-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenyl)-3,6-dihydro-2H-pyridin-1-ium.
| Compound Name | 1,1-dimethyl-4-(2-propan-2-ylidene-9-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenyl)-3,6-dihydro-2H-pyridin-1-ium |
|---|---|
| PubChem CID | 10367392 |
| Molecular Formula | C25H28N+ |
| Molecular Weight | 342.51 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | 1,1-dimethyl-4-(2-propan-2-ylidene-9-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenyl)-3,6-dihydro-2H-pyridin-1-ium |
| SMILES | CC(C)=C1c2ccccc2C=C(C2=CC[N+](C)(C)CC2)c2ccccc21 |
| InChI | InChI=1S/C25H28N/c1-18(2)25-21-10-6-5-9-20(21)17-24(22-11-7-8-12-23(22)25)19-13-15-26(3,4)16-14-19/h5-13,17H,14-16H2,1-4H3/q+1 |
| InChIKey | DWKAJPJKOFTPSG-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.51 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|