C13H9NO2 — CID 171573690
4-(1-oxoinden-2-yl)-1,2-dihydropyrrol-5-one (PubChem CID 171573690) has the molecular formula C13H9NO2 and a molecular weight of 211.22 g/mol. Its IUPAC name is 4-(1-oxoinden-2-yl)-1,2-dihydropyrrol-5-one.
| Compound Name | 4-(1-oxoinden-2-yl)-1,2-dihydropyrrol-5-one |
|---|---|
| PubChem CID | 171573690 |
| Molecular Formula | C13H9NO2 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.06 |
| IUPAC Name | 4-(1-oxoinden-2-yl)-1,2-dihydropyrrol-5-one |
| SMILES | O=C1NCC=C1C1=Cc2ccccc2C1=O |
| InChI | InChI=1S/C13H9NO2/c15-12-9-4-2-1-3-8(9)7-11(12)10-5-6-14-13(10)16/h1-5,7H,6H2,(H,14,16) |
| InChIKey | MUTUJJTWIQMVPP-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |