C10H10N2O3S — CID 103686497
N-(2-hydroxy-2-thiophen-3-ylethyl)-1,2-oxazole-3-carboxamide (PubChem CID 103686497) has the molecular formula C10H10N2O3S and a molecular weight of 238.27 g/mol. Its IUPAC name is N-(2-hydroxy-2-thiophen-3-ylethyl)-1,2-oxazole-3-carboxamide.
| Compound Name | N-(2-hydroxy-2-thiophen-3-ylethyl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 103686497 |
| Molecular Formula | C10H10N2O3S |
| Molecular Weight | 238.27 g/mol |
| Exact Mass | 238.04 |
| IUPAC Name | N-(2-hydroxy-2-thiophen-3-ylethyl)-1,2-oxazole-3-carboxamide |
| SMILES | O=C(NCC(O)c1ccsc1)c1ccon1 |
| InChI | InChI=1S/C10H10N2O3S/c13-9(7-2-4-16-6-7)5-11-10(14)8-1-3-15-12-8/h1-4,6,9,13H,5H2,(H,11,14) |
| InChIKey | HOIBCOXNNJBRMA-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.27 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |