C27H26Cl2N4OS — CID 10369565
7-(2,4-dichloro-5-methoxyanilino)-2-[4-[(3-methylbutylamino)methyl]phenyl]thieno[3,2-b]pyridine-6-carbonitrile (PubChem CID 10369565) has the molecular formula C27H26Cl2N4OS and a molecular weight of 525.51 g/mol. Its IUPAC name is 7-(2,4-dichloro-5-methoxyanilino)-2-[4-[(3-methylbutylamino)methyl]phenyl]thieno[3,2-b]pyridine-6-carbonitrile.
| Compound Name | 7-(2,4-dichloro-5-methoxyanilino)-2-[4-[(3-methylbutylamino)methyl]phenyl]thieno[3,2-b]pyridine-6-carbonitrile |
|---|---|
| PubChem CID | 10369565 |
| Molecular Formula | C27H26Cl2N4OS |
| Molecular Weight | 525.51 g/mol |
| Exact Mass | 524.12 |
| IUPAC Name | 7-(2,4-dichloro-5-methoxyanilino)-2-[4-[(3-methylbutylamino)methyl]phenyl]thieno[3,2-b]pyridine-6-carbonitrile |
| SMILES | COc1cc(Nc2c(C#N)cnc3cc(-c4ccc(CNCCC(C)C)cc4)sc23)c(Cl)cc1Cl |
| InChI | InChI=1S/C27H26Cl2N4OS/c1-16(2)8-9-31-14-17-4-6-18(7-5-17)25-12-23-27(35-25)26(19(13-30)15-32-23)33-22-11-24(34-3)21(29)10-20(22)28/h4-7,10-12,15-16,31H,8-9,14H2,1-3H3,(H,32,33) |
| InChIKey | QGUZLYNLOIHARS-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.51 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|