C11H13BrN2 — CID 103701794
N-[(5-bromo-2-pyridinyl)methyl]pent-4-yn-1-amine (PubChem CID 103701794) has the molecular formula C11H13BrN2 and a molecular weight of 253.14 g/mol. Its IUPAC name is N-[(5-bromo-2-pyridinyl)methyl]pent-4-yn-1-amine.
| Compound Name | N-[(5-bromo-2-pyridinyl)methyl]pent-4-yn-1-amine |
|---|---|
| PubChem CID | 103701794 |
| Molecular Formula | C11H13BrN2 |
| Molecular Weight | 253.14 g/mol |
| Exact Mass | 252.03 |
| IUPAC Name | N-[(5-bromo-2-pyridinyl)methyl]pent-4-yn-1-amine |
| SMILES | C#CCCCNCc1ccc(Br)cn1 |
| InChI | InChI=1S/C11H13BrN2/c1-2-3-4-7-13-9-11-6-5-10(12)8-14-11/h1,5-6,8,13H,3-4,7,9H2 |
| InChIKey | FVFOAJSPFCDMRR-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.14 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|