C14H14Cl2FNO2 — CID 103715691
3-[1-(2,4-dichloro-5-fluorophenyl)-1-hydroxyethyl]oxane-3-carbonitrile (PubChem CID 103715691) has the molecular formula C14H14Cl2FNO2 and a molecular weight of 318.18 g/mol. Its IUPAC name is 3-[1-(2,4-dichloro-5-fluorophenyl)-1-hydroxyethyl]oxane-3-carbonitrile.
| Compound Name | 3-[1-(2,4-dichloro-5-fluorophenyl)-1-hydroxyethyl]oxane-3-carbonitrile |
|---|---|
| PubChem CID | 103715691 |
| Molecular Formula | C14H14Cl2FNO2 |
| Molecular Weight | 318.18 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | 3-[1-(2,4-dichloro-5-fluorophenyl)-1-hydroxyethyl]oxane-3-carbonitrile |
| SMILES | CC(O)(c1cc(F)c(Cl)cc1Cl)C1(C#N)CCCOC1 |
| InChI | InChI=1S/C14H14Cl2FNO2/c1-13(19,14(7-18)3-2-4-20-8-14)9-5-12(17)11(16)6-10(9)15/h5-6,19H,2-4,8H2,1H3 |
| InChIKey | OHXCHDABRRZVPZ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.18 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|