C35H33N3O8 — CID 10371724
methyl (2S)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2-nitro-5-phenylmethoxyphenyl)propanoyl]amino]propanoate (PubChem CID 10371724) has the molecular formula C35H33N3O8 and a molecular weight of 623.66 g/mol. Its IUPAC name is methyl (2S)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2-nitro-5-phenylmethoxyphenyl)propanoyl]amino]propanoate.
| Compound Name | methyl (2S)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2-nitro-5-phenylmethoxyphenyl)propanoyl]amino]propanoate |
|---|---|
| PubChem CID | 10371724 |
| Molecular Formula | C35H33N3O8 |
| Molecular Weight | 623.66 g/mol |
| Exact Mass | 623.23 |
| IUPAC Name | methyl (2S)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2-nitro-5-phenylmethoxyphenyl)propanoyl]amino]propanoate |
| SMILES | COC(=O)[C@H](C)NC(=O)[C@H](Cc1cc(OCc2ccccc2)ccc1[N+](=O)[O-])NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C35H33N3O8/c1-22(34(40)44-2)36-33(39)31(19-24-18-25(16-17-32(24)38(42)43)45-20-23-10-4-3-5-11-23)37-35(41)46-21-30-28-14-8-6-12-26(28)27-13-7-9-15-29(27)30/h3-18,22,30-31H,19-21H2,1-2H3,(H,36,39)(H,37,41)/t22-,31-/m0/s1 |
| InChIKey | OHZCXMLBFQIFLX-UGDMGKLASA-N |
| XLogP | 5.30 |
| TPSA | 146.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.66 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|