C12H19BrN2O4S — CID 103720596
2-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylamino]-N-ethylethanesulfonamide (PubChem CID 103720596) has the molecular formula C12H19BrN2O4S and a molecular weight of 367.27 g/mol. Its IUPAC name is 2-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylamino]-N-ethylethanesulfonamide.
| Compound Name | 2-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylamino]-N-ethylethanesulfonamide |
|---|---|
| PubChem CID | 103720596 |
| Molecular Formula | C12H19BrN2O4S |
| Molecular Weight | 367.27 g/mol |
| Exact Mass | 366.02 |
| IUPAC Name | 2-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylamino]-N-ethylethanesulfonamide |
| SMILES | CCNS(=O)(=O)CCNCc1cc(Br)c(O)c(OC)c1 |
| InChI | InChI=1S/C12H19BrN2O4S/c1-3-15-20(17,18)5-4-14-8-9-6-10(13)12(16)11(7-9)19-2/h6-7,14-16H,3-5,8H2,1-2H3 |
| InChIKey | BTPNQQJZTJGAKT-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.27 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|