C23H33N7O12P2 — CID 10372208
[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [(2R,3S)-2-[[(3-carbamoylphenyl)methylamino]methyl]-3-hydroxybutyl] hydrogen phosphate (PubChem CID 10372208) has the molecular formula C23H33N7O12P2 and a molecular weight of 661.50 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [(2R,3S)-2-[[(3-carbamoylphenyl)methylamino]methyl]-3-hydroxybutyl] hydrogen phosphate.
| Compound Name | [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [(2R,3S)-2-[[(3-carbamoylphenyl)methylamino]methyl]-3-hydroxybutyl] hydrogen phosphate |
|---|---|
| PubChem CID | 10372208 |
| Molecular Formula | C23H33N7O12P2 |
| Molecular Weight | 661.50 g/mol |
| Exact Mass | 661.17 |
| IUPAC Name | [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [(2R,3S)-2-[[(3-carbamoylphenyl)methylamino]methyl]-3-hydroxybutyl] hydrogen phosphate |
| SMILES | C[C@H](O)[C@H](CNCc1cccc(C(N)=O)c1)COP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C23H33N7O12P2/c1-12(31)15(7-26-6-13-3-2-4-14(5-13)21(25)34)8-39-43(35,36)42-44(37,38)40-9-16-18(32)19(33)23(41-16)30-11-29-17-20(24)27-10-28-22(17)30/h2-5,10-12,15-16,18-19,23,26,31-33H,6-9H2,1H3,(H2,25,34)(H,35,36)(H,37,38)(H2,24,27,28)/t12-,15+,16+,18+,19+,23+/m0/s1 |
| InChIKey | ZHHUTCOZGZLMEI-MNSQAFQWSA-N |
| XLogP | -0.84 |
| TPSA | 296.95 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.50 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|