C9H13F3N2O3S — CID 103726316
3-(2-oxo-1,3-thiazolidin-3-yl)-N-(3,3,3-trifluoro-2-hydroxypropyl)propanamide (PubChem CID 103726316) has the molecular formula C9H13F3N2O3S and a molecular weight of 286.27 g/mol. Its IUPAC name is 3-(2-oxo-1,3-thiazolidin-3-yl)-N-(3,3,3-trifluoro-2-hydroxypropyl)propanamide.
| Compound Name | 3-(2-oxo-1,3-thiazolidin-3-yl)-N-(3,3,3-trifluoro-2-hydroxypropyl)propanamide |
|---|---|
| PubChem CID | 103726316 |
| Molecular Formula | C9H13F3N2O3S |
| Molecular Weight | 286.27 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | 3-(2-oxo-1,3-thiazolidin-3-yl)-N-(3,3,3-trifluoro-2-hydroxypropyl)propanamide |
| SMILES | O=C(CCN1CCSC1=O)NCC(O)C(F)(F)F |
| InChI | InChI=1S/C9H13F3N2O3S/c10-9(11,12)6(15)5-13-7(16)1-2-14-3-4-18-8(14)17/h6,15H,1-5H2,(H,13,16) |
| InChIKey | FXFXTUNPYGJYFF-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.27 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|