C17H21ClN2O — CID 103730509
N-(6-chloro-5-methyl-3-pyridinyl)adamantane-1-carboxamide (PubChem CID 103730509) has the molecular formula C17H21ClN2O and a molecular weight of 304.82 g/mol. Its IUPAC name is N-(6-chloro-5-methyl-3-pyridinyl)adamantane-1-carboxamide.
| Compound Name | N-(6-chloro-5-methyl-3-pyridinyl)adamantane-1-carboxamide |
|---|---|
| PubChem CID | 103730509 |
| Molecular Formula | C17H21ClN2O |
| Molecular Weight | 304.82 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | N-(6-chloro-5-methyl-3-pyridinyl)adamantane-1-carboxamide |
| SMILES | Cc1cc(NC(=O)C23CC4CC(CC(C4)C2)C3)cnc1Cl |
| InChI | InChI=1S/C17H21ClN2O/c1-10-2-14(9-19-15(10)18)20-16(21)17-6-11-3-12(7-17)5-13(4-11)8-17/h2,9,11-13H,3-8H2,1H3,(H,20,21) |
| InChIKey | PIJPMFPGDXEWNX-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.82 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|