C11H15F4NO — CID 103732113
N-[2-(cyclohexen-1-yl)ethyl]-2,2,3,3-tetrafluoropropanamide (PubChem CID 103732113) has the molecular formula C11H15F4NO and a molecular weight of 253.24 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-2,2,3,3-tetrafluoropropanamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-2,2,3,3-tetrafluoropropanamide |
|---|---|
| PubChem CID | 103732113 |
| Molecular Formula | C11H15F4NO |
| Molecular Weight | 253.24 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-2,2,3,3-tetrafluoropropanamide |
| SMILES | O=C(NCCC1=CCCCC1)C(F)(F)C(F)F |
| InChI | InChI=1S/C11H15F4NO/c12-9(13)11(14,15)10(17)16-7-6-8-4-2-1-3-5-8/h4,9H,1-3,5-7H2,(H,16,17) |
| InChIKey | DZHWSPSDJYJHMA-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.24 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|