C8H10F4N2O2 — CID 103733449
4-(2,2,3,3-tetrafluoropropanoyl)-1,4-diazepan-2-one (PubChem CID 103733449) has the molecular formula C8H10F4N2O2 and a molecular weight of 242.17 g/mol. Its IUPAC name is 4-(2,2,3,3-tetrafluoropropanoyl)-1,4-diazepan-2-one.
| Compound Name | 4-(2,2,3,3-tetrafluoropropanoyl)-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 103733449 |
| Molecular Formula | C8H10F4N2O2 |
| Molecular Weight | 242.17 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | 4-(2,2,3,3-tetrafluoropropanoyl)-1,4-diazepan-2-one |
| SMILES | O=C1CN(C(=O)C(F)(F)C(F)F)CCCN1 |
| InChI | InChI=1S/C8H10F4N2O2/c9-6(10)8(11,12)7(16)14-3-1-2-13-5(15)4-14/h6H,1-4H2,(H,13,15) |
| InChIKey | UCPYXVVZMWHBRM-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.17 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|