C11H12BrN3O — CID 103744517
N-[(2-bromophenyl)methyl]-2-(1,2,4-oxadiazol-5-yl)ethanamine (PubChem CID 103744517) has the molecular formula C11H12BrN3O and a molecular weight of 282.14 g/mol. Its IUPAC name is N-[(2-bromophenyl)methyl]-2-(1,2,4-oxadiazol-5-yl)ethanamine.
| Compound Name | N-[(2-bromophenyl)methyl]-2-(1,2,4-oxadiazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 103744517 |
| Molecular Formula | C11H12BrN3O |
| Molecular Weight | 282.14 g/mol |
| Exact Mass | 281.02 |
| IUPAC Name | N-[(2-bromophenyl)methyl]-2-(1,2,4-oxadiazol-5-yl)ethanamine |
| SMILES | Brc1ccccc1CNCCc1ncno1 |
| InChI | InChI=1S/C11H12BrN3O/c12-10-4-2-1-3-9(10)7-13-6-5-11-14-8-15-16-11/h1-4,8,13H,5-7H2 |
| InChIKey | JLENWHSFYUOANF-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.14 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|